ଛାଞ୍ଚ:Infobox drug/doc/names and identifiers
From Wikipedia, the free encyclopedia
More information parameter, label ...
Names and identifiers in {{Infobox drug}} | ||||||
---|---|---|---|---|---|---|
parameter | label | demo | order | group | note | |
{{PAGENAME}} | Amoxicillin | 00 !top | title | Infobox title | ||
drug_name = |
N,N-Dimethyltryptamine | 00.1 !top | title | demo:1; overwrites {{PAGENAME}} | ||
(type=vacc,mab,comb,other) | 01 | type | See /doc/type-sections | |||
IUPAC_name = | Systematic (IUPAC) name | (2S,5R,6R)-6-{[(2R)-2-aminoetc. |
02 | type | Plain, long | |
SMILES = orsmiles = |
SMILES | O=C(O)[C@@H]2N3C(=O)[C@@H]etc. |
03 | type | Plain, long, collapses | |
StdInChI = StdInChIKey = | InChI | InChI=1S/C16H19N3O5S/c1-16(2)11etc.
Key:LSQZJLSetc. |
04 | type | Long, collapses. Not InChI, InChIKey | |
Clinical data | 20 | clinical | ||||
tradename = | Trade names | Actimoxi, Alphamox, etc. | 21 | clinical | Plain demo | |
Drugs.com = | AHFS/Drugs.com | monograph | 23 | clinical | Input by {{drugs.com}} | |
MedlinePlus = | MedlinePlus | a685001 | 25 | clinical | ||
licence_EU = DailyMedID = licence_US = | Licence data |
|
26 | clinical | DailyMedID overwrites licence_US | |
Identifiers | 50 | id | ||||
CAS_number = CAS_supplemental = | CAS Registry Number | 91161-71-6 78628-80-5 | 51 | id | demo:4 | |
ATC_prefix = ATC_suffix = ATC_supplement = ATCvet = | ATC code or ATCvet code |
ATCvet=no |ATC_prefix=J01 |ATC_suffix=CA04 |ATC_supplemental=QG51AA03 (WHO) }} | 52 | class | Multi-input, interaction. Numbers have split wl+el! | |
PubChem = orPubChemSubstance = (SID) | PubChem | CID: 33613 | 53 | id | Only one is shown | |
IUPHAR_ligand = |
IUPHAR/BPS | 4139 | 54 | id | demo:2 | |
DrugBank = |
DrugBank | DB01060 | 55 | id | ||
ChemSpiderID = |
ChemSpider | 31006 | 56 | id | +Option '=none' | |
UNII = |
UNII | 9EM05410Q9 | 57 | id | ||
KEGG = |
KEGG | D07452 | 58 | id | ||
ChEBI = |
ChEBI | CHEBI:2676 | 59 | id | ||
ChEMBL = |
ChEMBL | CHEMBL1082 | 61 | id | ||
NIAID_ChemDB = |
NIAID ChemDB | 059486 | 62 | id | demo:3; HIV/AIDS related | |
synonyms = |
Synonyms | 2-acetoxybenzoic acid acetylsalicylate etc. |
63 | id | demo:2; Plain, list | |
PDB_ligand = |
PDB ligand ID | AIN (PDBe, RCSB PDB) | 64 | id | demo:2 | |
E_number = |
E number | E703 | 65 | id | Oxytetracycline |
Close
- Notes: Demo data is taken from: default=Amoxicillin, demo:1=N,N-Dimethyltryptamine, demo:2=Aspirin, demo:3=Enfuvirtide (NIAID, HIV), demo:4=Terbinafine (CAS), demo:5= Thioridazine (licence EU), demo:6 (DailyMedID), demo:7=Thioridazine (licence US)
Usage
The above documentation is transcluded from ଛାଞ୍ଚ:Infobox drug/doc/names and identifiers/doc. (edit | history)
Editors can experiment in this template's sandbox (create | mirror) and testcases (create) pages.
Add categories to the /doc subpage. Subpages of this template.
Editors can experiment in this template's sandbox (create | mirror) and testcases (create) pages.
Add categories to the /doc subpage. Subpages of this template.