konposatu kimiko From Wikipedia, the free encyclopedia
Triptofanoa[1] (Trp) proteinen osagaia den aminoazido esentzialetako bat da, beraz dieta bidez hartu beharrekoa. Azido 2-amino-3-(1H-indol-3-il)propioniko honen formula kimikoa HO2CCH2(NH2)CH2(C8NH6) da eta UGG kodonaren bidez adierazten da.
Triptofano | |
---|---|
![]() | |
Formula kimikoa | C11H12N2O2 |
SMILES kanonikoa | 2D eredua |
SMILES isomerikoa | N[C@@H](CC1=CNC2=C1C=CC=C2)C(O)=O |
MolView | 3D eredua |
Konposizioa | Nitrogeno eta karbono |
Mota | tryptamine alkaloid (en) ![]() ![]() ![]() ![]() |
Estereoisomeroa | D-Tryptophan (en) ![]() ![]() ![]() |
Tautomeroa | L-tryptophan zwitterion (en) ![]() |
Ezaugarriak | |
Azidotasuna (pKa) | 9,39 |
Masa molekularra | 204,09 Da |
Erabilera | |
Interakzioak | linezolid (en) ![]() ![]() ![]() ![]() ![]() ![]() ![]() ![]() ![]() ![]() ![]() ![]() |
Elkarrekintza | calcium sensing receptor (en) ![]() ![]() ![]() ![]() |
Rola | second-generation antidepressive agents (en) ![]() |
Identifikatzaileak | |
InChlKey | QIVBCDIJIAJPQS-VIFPVBQESA-N |
CAS zenbakia | 73-22-3 |
ChemSpider | 6066 |
PubChem | 6305 eta 6923516 |
Reaxys | 86197 |
Gmelin | 16828 eta 57912 |
ChEBI | 51434 |
ChEMBL | CHEMBL54976 |
ZVG | 100457 |
EC zenbakia | 200-795-6 |
ECHA | 100.000.723 |
MeSH | D014364 |
RxNorm | 10898 |
Human Metabolome Database | HMDB0000929 |
UNII | 8DUH1N11BX |
NDF-RT | N0000180301 eta N0000146988 |
KEGG | D00020 eta C00078 |
PDB Ligand | TRP |
Molekula hidrofobikoa da, hau da, uretan disolbaezina albo katean indol talde bat duelako.
Gainera, serotonina neurotransmisorearen askapenerako ezinbestekoa da. Honi esker, antsietatea, insomnioa eta estresa erregulatzen dira.
Seamless Wikipedia browsing. On steroids.
Every time you click a link to Wikipedia, Wiktionary or Wikiquote in your browser's search results, it will show the modern Wikiwand interface.
Wikiwand extension is a five stars, simple, with minimum permission required to keep your browsing private, safe and transparent.