Kapsaizina piper minetan dagoen molekula bat da, hain zuzen, mingarritasuna ematen dioten molekula da.[1] Kapsaizina eta beste substantzia antzeko batzuk kapsaizinoideak dira, eta bigarren mailako metabolito gisa sortzen dira Capsicum generoko hainbat landare-espezietan, eta horrek, ziurrenik, animalia belarjaleek kontsumitzea eragozten die.
| Kapsaizina | |
|---|---|
 | |
| Formula kimikoa | C18H27NO3 |
| SMILES kanonikoa | 2D eredua |
| SMILES isomerikoa | CC(C)/C=C/CCCCC(=O)NCC1=CC(=C(C=C1)O)OC |
| MolView | 3D eredua |
| Konposizioa | Nitrogeno eta karbono |
| Zeren produktua | Capsicum |
| Mota | capsaicinoid (en)  eta N-acyl amines (en) |
| Ezaugarriak | |
| Fusio-puntua | 63,5 °C |
| Masa molekularra | 305,199 Da |
| Erabilera | |
| Konposatu aktiboa | Qutenza (en) |
| Tratatzen du | min, diabetic polyneuropathy (en) , Herpes zoster eta neuropatia periferiko |
| Elkarrekintza | CFTR, Potassium voltage-gated channel, shaker-related subfamily, member 1 (en) , Potassium voltage-gated channel, shaker-related subfamily, member 7 (en) , Potassium voltage gated channel, Shaw-related subfamily, member 1 (en) , Transient receptor potential cation channel subfamily V member 1 (en) , Transient receptor potential cation channel, subfamily V, member 1 (en) eta Transient receptor potential cation channel subfamily V member 6 (en) |
| Rola | antipruriginoso, sensory system agents (en) eta lachrymatory agent (en) |
| Arriskuak | |
| NFPA 704 |  1
2
0
|
| Identifikatzaileak | |
| InChlKey | YKPUWZUDDOIDPM-SOFGYWHQSA-N |
| CAS zenbakia | 404-86-4 |
| ChemSpider | 1265957 |
| PubChem | 1548943 |
| Reaxys | 2816484 |
| Gmelin | 3374 |
| ChEMBL | CHEMBL294199 |
| EC zenbakia | 206-969-8 |
| ECHA | 100.006.337 |
| CosIng | 74864 |
| MeSH | D002211 |
| RxNorm | 1992 |
| Human Metabolome Database | HMDB0002227 |
| KNApSAcK | C00052221 |
| UNII | S07O44R1ZM |
| NDF-RT | N0000147626 |
| KEGG | C06866 eta D00250 |
| PDB Ligand | 4DY |
Erreferentziak
Kanpo estekak
Wikiwand in your browser!
Seamless Wikipedia browsing. On steroids.
Every time you click a link to Wikipedia, Wiktionary or Wikiquote in your browser's search results, it will show the modern Wikiwand interface.
Wikiwand extension is a five stars, simple, with minimum permission required to keep your browsing private, safe and transparent.
