Kantaxantina xantofila mota bat da, kolore morea duen pigmentu bat da.
| Kantaxantina | |
|---|---|
 | |
| Formula kimikoa | C40H52O2 |
| SMILES kanonikoa | 2D eredua |
| SMILES isomerikoa | CC(\C=C\C=C(C)\C=C\C1=C(C)C(=O)CCC1(C)C)=C/C=C/C=C(C)/C=C/C=C(C)/C=C/C2=C(C)C(=O)CCC2(C)C |
| MolView | 3D eredua |
| Konposizioa | karbono, oxigeno eta hidrogeno |
| Mota | Karotenoide |
| Masa molekularra | 564,396730904 Da |
| Erabilera | |
| Rola | Antioxidatzaile |
| Identifikatzaileak | |
| InChlKey | FDSDTBUPSURDBL-DKLMTRRASA-N |
| CAS zenbakia | 514-78-3 |
| ChemSpider | 4447582 |
| PubChem | 5281227 |
| Reaxys | 1898520 |
| Gmelin | 3362 |
| ChEMBL | CHEMBL1329004 |
| ZVG | 104545 |
| EC zenbakia | 208-187-2 |
| ECHA | 100.007.444 |
| CosIng | 32751 |
| MeSH | D016644 |
| RxNorm | 42348 |
| Human Metabolome Database | HMDB0003154 |
| KNApSAcK | C00000922 |
| UNII | 4C3C6403MU |
| KEGG | C08583 |
| PDB Ligand | 45H |
Zizahori (Cantharellus cibarius) onddotik isolatu zen aurrenekoz, hortik izena. Ordutik beste hainbat izaki bizidunetan aurkitu da, bakterio, alga berde, krustazeo, eta bioakumulazioaren eraginez arrain eta hegaztietan ere bai.
Kantaxantina antioxidatzaile oso eraginkorra da animalien ehunetan[1][2].
Azala belzteko produktuetan erabili izan da baina begiko kristalinoaren retinopatia kasu batzuk agertu izan dira[3].
Izokin eta amuarrain haztegietan elikagai gisa erabiltzen da[4].
Wikiwand in your browser!
Seamless Wikipedia browsing. On steroids.
Every time you click a link to Wikipedia, Wiktionary or Wikiquote in your browser's search results, it will show the modern Wikiwand interface.
Wikiwand extension is a five stars, simple, with minimum permission required to keep your browsing private, safe and transparent.
