konposatu kimiko From Wikipedia, the free encyclopedia
Guanosina trifosfatoa edo GTP nukleotido bat da, guanosinaz, erribosaz eta hiru fosfato taldez osatua. Nukleotido trifosfatoa da, beraz. Formula kimikoa C10H16N5O14P3 du[1].
Guanosina trifosfato | |
---|---|
Formula kimikoa | C10H16N5O14P3 |
SMILES kanonikoa | 2D eredua |
SMILES isomerikoa | C1=NC2=C(N1[C@H]3[C@@H]([C@@H]([C@H](O3)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O)O)NC(=NC2=O)N |
MolView | 3D eredua |
Konposizioa | Nitrogeno, oxigeno eta karbono |
Mota | purine ribonucleoside 5'-triphosphate (en) |
Masa molekularra | 522,991 Da |
Erabilera | |
Elkarrekintza | Potassium inwardly-rectifying channel, subfamily J, member 8 (en) eta Pyrimidinergic receptor P2Y4 (en) |
Rola | primary metabolite (en) |
Identifikatzaileak | |
InChlKey | XKMLYUALXHKNFT-UUOKFMHZSA-N |
CAS zenbakia | 86-01-1 |
ChemSpider | 6569 |
PubChem | 6830 eta 135398633 |
Reaxys | 1201437 eta 74004 |
Gmelin | 15996 |
ChEMBL | CHEMBL1233147 |
EC zenbakia | 201-647-3 |
ECHA | 100.001.498 |
MeSH | D006160 |
Human Metabolome Database | HMDB0001273 |
KNApSAcK | C00007223 |
UNII | 01WV7J708X |
KEGG | C00044 |
PDB Ligand | GTP |
Guanosina trifosfatoa (GTP) guanosina difosfatoa (GDP) fosforilatzen denean agertzen da.
Hainbat funtzio betetzen ditu GTPak:
Seamless Wikipedia browsing. On steroids.
Every time you click a link to Wikipedia, Wiktionary or Wikiquote in your browser's search results, it will show the modern Wikiwand interface.
Wikiwand extension is a five stars, simple, with minimum permission required to keep your browsing private, safe and transparent.