Irilone is an isoflavone, a type of flavonoid. It can be found in Trifolium pratense (red clover),[1] in Iris unguicularis[2] and in Iris germanica.[3]
Quick facts Names, Identifiers ...
Irilone
 Chemical structure of irilone |
 |
| Names |
| IUPAC name
4′,9-Dihydroxy-6,7-[methylenebis(oxy)]isoflavone |
Systematic IUPAC name
9-Hydroxy-7-(4-hydroxyphenyl)-2H,8H-[1,3]dioxolo[4,5-g][1]benzopyran-8-one |
| Identifiers |
|
|
|
|
| ChEBI |
|
| ChemSpider |
|
| KEGG |
|
|
|
|
|
InChI=1S/C16H10O6/c17-9-3-1-8(2-4-9)10-6-20-11-5-12-16(22-7-21-12)15(19)13(11)14(10)18/h1-6,17,19H,7H2 N Key: NUGRQNBDTZWXTP-UHFFFAOYSA-N N InChI=1/C16H10O6/c17-9-3-1-8(2-4-9)10-6-20-11-5-12-16(22-7-21-12)15(19)13(11)14(10)18/h1-6,17,19H,7H2 Key: NUGRQNBDTZWXTP-UHFFFAOYAV
|
C1OC2=C(O1)C(=C3C(=C2)OC=C(C3=O)C4=CC=C(C=C4)O)O
|
| Properties |
|
C16H10O6 |
| Molar mass |
298.24 g/mol |
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa). |
Close
