Borate carbonate

Mixed anion compound containing both borate and carbonate ions From Wikipedia, the free encyclopedia

The borate carbonates are mixed anion compounds containing both borate and carbonate ions. Compared to mixed anion compounds containing halides, these are quite rare. They are hard to make, requiring higher temperatures, which are likely to decompose carbonate to carbon dioxide. The reason for the difficulty of formation is that when entering a crystal lattice, the anions have to be correctly located, and correctly oriented.[1] They are also known as carbonatoborates or borocarbonates.[2] Although these compounds have been termed carboborate, that word also refers to the C=B=C5− anion, or CB11H12 anion.[3] This last anion should be called 1-carba-closo-dodecaborate[4] or monocarba-closo-dodecaborate.[5]

Some borate carbonates have additional different anions and can be borate carbonate halides or borate carbonate nitrites.

List

Summarize
Perspective
More information chem, mw ...
chem mw crystal system space group unit cell volume density comment references
Qilianshanite NaHCO3 · H3BO3 · 2H2O monoclinic a = 16.11 Å, b = 6.92 Å, c = 6.73 Å

β = 100.46°

1.635 Biaxial (-) nα = 1.351 nβ = 1.459 nγ = 1.486

2V: 50°

Max birefringence δ = 0.135

[6]
Canavesite Mg2(HBO3)(CO3) · 5H2O monoclinic a = 23.49(2) Å, b = 6.16(6) Å, c = 21.91(2) Å

β = 114.91(9)° Z=12?

1.790 Biaxial (+) nα = 1.485 nβ = 1.494 nγ = 1.505

2V: 86°

Max birefringence: δ = 0.020

[7]
Potassium bis(carbonato)borate hydrate K[B(CO2-μ-O-CO2)2]·2H2O orthorhombic Aba2 a=11.058 b=11.169 c=9.0504 Z=4 1117.8 spiro at boron [8]
NaK15[B4O5(OH)4]6(NO2)2(CO3)·7H2O 2035.26 hexagonal P62c a=11.1399 c=30.495 Z=2 3277.3 2.062 [9]
K9[B4O5(OH)4]3(CO3)OH7 H2O 1128.82 P62c a=11.207 c=17.193 Z=2 1870.2 2.005 [10]
K9[B4O5(OH)4]3(CO3)Cl·7H2O 1147.29 hexagonal P62c a=11.219 c=17.079 Z=2 1861.8 2.047 [11]
K9[B4O5(OH)4]3(CO3)Br·7H2O 1191.75 hexagonal P62c a=11.243 c=17.132 Z=2 1875.4 2.110 [11]
K9[B4O5(OH)4]3(CO3)I7 H2O 1238.74 P62c a=11.234 c=17.158 Z=2 1875.2 2.194 [10]
Ca4(Ca0.7Na0.3)3(Na0.70.3)Li5[B t12BΔ10O36(O,OH)6](CO3)(OH) · (OH,H2O) R3 a=8.99 c=35.91 Z=3 2513 2.62 [12]
Chiyokoite Ca3Si(CO3){[B(OH)4]0.5(AsO3)0.5}(OH)6 · 12H2O hexagonal P63 a = 11.0119, c = 10.5252 1,105.31 [13]
Carboborite Ca2Mg[B(OH)4]2(CO3)2 · 4H2O monoclinic a = 18.59 Å, b = 6.68 Å, c = 11.32 Å

β = 91.68°

Biaxial (-) nα = 1.507 nβ = 1.546 nγ = 1.569

Max Birefringence: δ = 0.062

[14]
Borcarite Ca4MgB4O5(OH)6(CO3)2 monoclinic C2/m a=17.840 b=8.380 c=4.445 β =102.04 649.906 2.790 Biaxial (-) nα = 1.590 nβ = 1.651 nγ = 1.657

2V: 30°

Max birefringence: δ = 0.067

[1][15]
Sakhaite Ca3Mg(BO3)2(CO3)2.(H2O)0.36 isometric Fd3m a = 14.685 Z=4 3166.8 [1][16]
Ca12Mg4(BO3)7(CO3)4(OH)Cl.H2O Fd3 [1]
Harkerite Ca12Mg4Al(BO3)3(SiO4)4(CO3)5 · H2O trigonal R3m a = 18.131 Å α = 33.46° 1614 Uniaxial nα = 1.649 - 1.653 nβ = 1.649 - 1.653 [17]
Imayoshiite Ca3Al(CO3)[B(OH)4](OH)6 · 12H2O hexagonal P63 a = 11.026, c = 10.605 1,117 1.79 Uniaxial (-) nω = 1.497(2) nε = 1.470(2)

Max birefringence δ = 0.027

[18]
Gaudefroyite Ca4Mn3O3(BO3)3CO3 hexagonal P63/m a = 10.6 Å, c = 5.9 Å 574 3.529 black

Uniaxial (+) nω = 1.805 - 1.810 nε = 2.015 - 2.020

Max Birefringence:δ = 0.210

[1][19]
Numanoite Ca4Cu(B4O6(OH)6)(CO3)2 monoclinic C2/m a = 17.794 Å, b = 8.381 Å, c = 4.4494 Å

β = 102.42° Z=2

bluish green

Biaxial (-) nα=1.618 nβ=1.658 nγ=1.672

2V: 60°

Max birefringence: δ = 0.054

[20]
Rb9[B4O5(OH)4]3(CO3)Cl7 H2O 1564.59 P62c a=11.325 c=17.181 Z=2 1908.3 2.502 [10]
Rb9[B4O5(OH)4]3(CO3)Br7 H2O 1609.08 P62c a=11.482 c=17.463 Z=2 1993.9 2.680 [10]
Rb9[B4O5(OH)4]3(CO3)I7 H2O 1656.07 P62c a=11.451 c=17.476 Z=2 1984.5 2.771 [10]
NaRb3B6O9(OH)3(HCO3) monoclinic P21 a = 8.988 Å, b = 8.889 Å, c = 10.068 Å, and β = 114.6° [21]
Sr5(CO3)2(BO3)2 orthorhombic Pnma a = 7.387 b = 16.556 c = 8.971 Z = 4 UV cut off 190 nm [22]
Sr2CuO2(CO3)0.85(BO3)0.15 I4 [1]
Sr(Na0.4Sr0.1)Na2[B5O8(OH)2] · (CO3)1 − x B2/b [23]
Moydite-(Y) Y[B(OH)4](CO3) orthorhombic [24]
K6[Cd2(CO3)2(B12O18)(OH)6] 1099.19 orthorhombic Pnnm a=13.0603 b=9.1059 c=12.3860 Z=2 1473.0 2.478 colorless [25]
Rb6[Cd2(CO3)2(B12O18)(OH)6] 1377.41 orthorhombic Pnnm a=13.3484 b=9.2665 c=12.4946 Z=2 1545.5 2.960 colorless [25]
Ba2(BO3)1-x(CO3)xClx x=0.1 P3m1 [1]
Ba3[B6O10(OH)2](CO3) 730.905 monoclinic a=6.5351, b=8.3455, c =11.3489, and β = 98.9568° Z=2 611.4 3.970 [26]
Ba5(CO3)2(BO3)2 924.34 orthorhombic Pnma a=7.923 b=17.508 c=9.114 Z=4 1268.4 4.84 [1]
Ba4Sr(CO3)2(BO3)2 874.63 orthorhombic Pnma a=7.731 b=17.349 c=9.048 Z=4 1213.6 7.787 [1]
Ba6[B12O21(OH)2](CO3)2 1443.80 monoclinic a =6.5485, b = 19.361, c = 18.120, and β = 90.893° Z=4 2297.0 4.175 [26]
Li9BaB15O27(CO3) P31c a=8.860, c=15.148 [1][27]
Ba3(BO3)(CO3)F 549.84 trigonal R3 a=10.1799 c=18.530 Z=9 1663.0 4.941 [28]
Pb7O(OH)3(CO3)3(BO3) 1756.19 hexagonal P63/mc a=10.519 c=8.90 Z=2 853 6.839 SHG 4.5×KDP [29]
Mereheadite Pb47O24(OH)13Cl25(BO3)2(CO3) monoclinic Cm a = 17.372, b = 27.942, c = 10.6661, β = 93.152o 5169.6 [30]
Britvinite [Pb7(OH)3F(BO3)2(CO3)][Mg4.5(OH)3(Si5O14)] triclinic P1 a = 9.3409, b = 9.3579, c = 18.833

α = 80.365°, β = 75.816°, γ = 59.870° Z=2

1378.7 5.51 Biaxial (-) nα = 1.896 nβ = 1.903 nγ = 1.903

2V 20°

Max birefringence δ = 0.007

[31]
Roymillerite Pb24Mg9(Si10O28)(CO3)10(BO3)(SiO4)(OH)13O5 triclinic P1 a = 9.316, b = 9.316, c = 26.463

α = 83.295°, β = 83.308°, γ = 60.023° Z=1

1971.2 5.973 Biaxial (-) nα = 1.860 nβ = 1.940 nγ = 1.940

2V 5°

Max birefringence δ = 0.080

[32]
Close

References

Loading related searches...

Wikiwand - on

Seamless Wikipedia browsing. On steroids.