Aurantinidin is a water-soluble, red plant dye. It is a member of the class of compounds known as anthocyanidins and is a hydroxy derivative of pelargonidin. Aurantinidin has been reported to occur in Impatiens aurantiaca (Balsaminaceae), and also in cultivars from genus Alstroemeria.[1]
Quick facts Names, Identifiers ...
Aurantinidin
 |
| Names |
| IUPAC name
3,4′,5,6,7-Pentahydroxyflavylium |
Systematic IUPAC name
3,5,6,7-Tetrahydroxy-2-(4-hydroxyphenyl)-1λ4-benzopyran-1-ylium |
| Other names
6-Hydroxypelargonidine |
| Identifiers |
|
|
|
|
| ChemSpider |
|
|
|
| UNII |
|
|
|
InChI=1S/C15H10O6/c16-8-3-1-7(2-4-8)15-11(18)5-9-12(21-15)6-10(17)14(20)13(9)19/h1-6H,(H4-,16,17,18,19,20)/p+1 Y Key: VGONRPRFJVEJKB-UHFFFAOYSA-O Y InChI=1/C15H10O6/c16-8-3-1-7(2-4-8)15-11(18)5-9-12(21-15)6-10(17)14(20)13(9)19/h1-6H,(H4-,16,17,18,19,20)/p+1 Key: VGONRPRFJVEJKB-IKLDFBCSAP
|
Oc1ccc(cc1)c3[o+]c2cc(O)c(O)c(O)c2cc3O
|
| Properties |
|
C15H11O6+ |
| Molar mass |
287.24 g/mol |
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa). |
Close
