Sodium pareth sulfate
Chemical compound / From Wikipedia, the free encyclopedia
Sodium pareth sulfate, also known as sodium polyoxyethylene alkyl ether sulfate, is a surfactant found in some detergent products such as hand or body washes, but not as commonly as other chemicals such as sodium laureth sulfate (SLES). It is the sodium salt of a sulfated polyethylene glycol ether.
Quick Facts Names, Identifiers ...
![]() | |
Names | |
---|---|
Other names
Sodium polyoxyethylene alkyl ether sulfate; alcohols, C10-16, ethoxylated, sulfates, sodium salts | |
Identifiers | |
ECHA InfoCard | 100.105.713 ![]() |
EC Number |
|
CompTox Dashboard (EPA) |
|
Properties | |
CH3(CH2)n(OCH2CH2)mOSO3Na | |
Molar mass | Variable |
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa).
|
Close
It is produced similarly to SLES starting from fatty alcohols with 10 to 16 carbon atoms.[1]