From Wikipedia, the free encyclopedia
సిట్రిక్ ఆమ్లం (Citric acid) ఒక బలహీనమైన ఆర్గానిక్ ఆమ్లం. దీనిని ఆహార పదార్ధాలలోను, పానీయాలలో ప్రిజర్వేటివ్ గాను, పుల్లని రుచి కోసం వాడుతున్నారు. రసాయన శాస్త్రంలో సిట్రిక్ ఆమ్లం అన్ని జీవులలోని జీవక్రియలో జరిగే సిట్రిక్ ఆమ్ల చక్రంలో మాధ్యమిక పదార్థం. ప్రపంచ వ్యాప్తంగా ప్రతి సంవత్సరం ఒక మిలియన్ టన్నుల కంటే ఎక్కువగా సిట్రిక్ ఆమ్లం ఉత్పత్తి అవుతున్నది.
పేర్లు | |
---|---|
IUPAC నామము
2-hydroxypropane-1,2,3-tricarboxylic acid | |
ఇతర పేర్లు
3-carboxy-3-hydroxypentanedioic acid | |
గుర్తింపు విషయాలు | |
సి.ఎ.ఎస్. సంఖ్య | [77-92-9] |
పబ్ కెమ్ | 311 |
డ్రగ్ బ్యాంకు | DB04272 |
కెగ్ | D00037 |
సి.హెచ్.ఇ.బి.ఐ | CHEBI:30769 |
SMILES | C(C(=O)O)C(CC(=O)O)(C(=O)O)O |
| |
ధర్మములు | |
C6H8O7 | |
మోలార్ ద్రవ్యరాశి | 192.124 g/mol (anhydrous) 210.14 g/mol (monohydrate) |
స్వరూపం | crystalline white solid |
సాంద్రత | 1.665 g/cm3(1.5g/cm3 for monohydrate) |
ద్రవీభవన స్థానం | 153 °C (307 °F; 426 K) |
బాష్పీభవన స్థానం | 175 °C (347 °F; 448 K) |
నీటిలో ద్రావణీయత |
73 g/100 ml (20 °C) |
ఆమ్లత్వం (pKa) | pKa1 = 3.09 pKa2 = 4.75 pKa3 = 5.41 [1] |
ప్రమాదాలు | |
ప్రధానమైన ప్రమాదాలు | skin and eye irritant |
సంబంధిత సమ్మేళనాలు | |
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa). | |
verify (what is ?) | |
Infobox references | |
Seamless Wikipedia browsing. On steroids.
Every time you click a link to Wikipedia, Wiktionary or Wikiquote in your browser's search results, it will show the modern Wikiwand interface.
Wikiwand extension is a five stars, simple, with minimum permission required to keep your browsing private, safe and transparent.