konposatu kimiko From Wikipedia, the free encyclopedia
Hiosziamina (C17H23NO3) belladonatik, estramoniotik eta beste landare solanazeo batzuetatik ateratzen den alkaloide pozoitsua da. Azido tropikoak eta tropinak osatutako esterea da. Begi-ninia zabaltzeko erabiltzen da batez ere.
| Hiosziamina | |
|---|---|
 | |
| Formula kimikoa | C17H23NO3 |
| SMILES kanonikoa | 2D eredua |
| SMILES isomerikoa | CN1[C@H]2CC[C@@H]1C[C@@H](C2)OC(=O)[C@H](CO)C3=CC=CC=C3 |
| MolView | 3D eredua |
| Konposizioa | Nitrogeno eta karbono |
| Mota | Pharmakon1600-01500346 (en)  eta (±)-hyoscyamine (en) |
| Estereoisomeroa | [[(1R,5S)-8-methyl-8-azabicyclo[3.2.1]oct-3-yl (2R)-3-hydroxy-2-phenylpropanoate|(1R,5S)-8-methyl-8-azabicyclo[3.2.1]oct-3-yl (2R)-3-hydroxy-2-phenylpropanoate]] (en) , (+)-hyoscyamine (en) , [[(2S)-3-hydroxy-2-phenylpropanoic acid [(1R,5R)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl] ester|(2S)-3-hydroxy-2-phenylpropanoic acid [(1R,5R)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl] ester]] (en) eta [[(S)-((1R,3r,5S)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl) 3-hydroxy-2-phenylpropanoate|(S)-((1R,3r,5S)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl) 3-hydroxy-2-phenylpropanoate]] (en) |
| Masa molekularra | 289,167793596 Da |
| Erabilera | |
| Tratatzen du | dardara, Enteropatia, neurogenic bladder (en) , koliko, muskuluetako arranpa, gehiegizko listu-jariatze, errinitis, Ultzera peptiko, hiperhidrosi eta heste minberaren sindrome |
| Rola | muscarinic antagonist (en) , antihistaminiko, serotonin antagonist (en) , antiarrhythmic agent (en) , Bronkozabaltzaile, parasympatholytic (en) , mydriatic (en) eta anesthesia adjuvants (en) |
| Identifikatzaileak | |
| InChlKey | RKUNBYITZUJHSG-FXUDXRNXSA-N |
| CAS zenbakia | 101-31-5 |
| ChemSpider | 10246417 |
| Reaxys | 91259 |
| Gmelin | 17486 |
| ChEMBL | CHEMBL1331216 |
| ZVG | 510260 |
| EC zenbakia | 202-933-0 |
| ECHA | 100.002.667 |
| MeSH | D064692 |
| RxNorm | 153970 |
| Human Metabolome Database | HMDB0014568 |
| KNApSAcK | C00002293 |
| UNII | PX44XO846X |
| NDF-RT | N0000146727 |
| KEGG | C02046 |
| PDB Ligand | HYO |
Seamless Wikipedia browsing. On steroids.
Every time you click a link to Wikipedia, Wiktionary or Wikiquote in your browser's search results, it will show the modern Wikiwand interface.
Wikiwand extension is a five stars, simple, with minimum permission required to keep your browsing private, safe and transparent.
