TME, or thiometaescaline, is a series of lesser-known psychedelic drugs similar in structure to mescaline. Their structures are based on that of metaescaline. They were first synthesized by Alexander Shulgin and recorded in his book PiHKAL (Phenethylamines i Have Known And Loved). Very little is known about their dangers or toxicity.
More information Names, Identifiers ...
3-TME
 |
| Names |
| IUPAC name
2-[3-(Ethylsulfanyl)-4,5-dimethoxyphenyl]ethanamine |
| Identifiers |
|
|
|
|
| ChEMBL |
|
| ChemSpider |
|
|
|
| UNII |
|
Key: WHUXWWJFRBXUOQ-UHFFFAOYSA-N InChI=1S/C12H19NO2S/c1-4-16-11-8-9(5-6-13)7-10(14-2)12(11)15-3/h7-8H,4-6,13H2,1-3H3
|
CCSC1=CC(=CC(=C1OC)OC)CCN
|
| Properties |
|
C12H19NO2S |
| Molar mass |
241.35 g·mol−1 |
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa). |
- Dosage: 60–100 mg
- Duration: 10–15 hours
- Effects: Strong entheogenic action, reduction of inhibition
|
4-TME
 |
| Names |
| IUPAC name
2-[3-Ethoxy-5-methoxy-4-(methylsulfanyl)phenyl]ethanamine |
| Identifiers |
|
|
|
|
| ChEMBL |
|
| ChemSpider |
|
|
|
Key: ACLYMWAQSAEILP-UHFFFAOYSA-N InChI=1S/C12H19NO2S/c1-4-15-11-8-9(5-6-13)7-10(14-2)12(11)16-3/h7-8H,4-6,13H2,1-3H3
|
|
| Properties |
|
C12H19NO2S |
| Molar mass |
241.35 g·mol−1 |
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa). |
- Dosage: 60–100 mg
- Duration: 10–15 hours
- Effects: Few to none
|
5-TME
 |
| Names |
| IUPAC name
2-[3-Ethoxy-4-methoxy-5-(methylsulfanyl)phenyl]ethanamine |
| Identifiers |
|
|
|
|
| ChEMBL |
|
| ChemSpider |
|
|
|
Key: BRABKKMYSDDDCR-UHFFFAOYSA-N InChI=1S/C12H19NO2S/c1-4-15-10-7-9(5-6-13)8-11(16-3)12(10)14-2/h7-8H,4-6,13H2,1-3H3
|
|
| Properties |
|
C12H19NO2S |
| Molar mass |
241.35 g·mol−1 |
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa). |
- Dosage: greater than 200 mg
- Duration: unknown
- Effects: Few to none
|
Close
